C25H31N5S — CID 15317888
(3R,3aR,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide (PubChem CID 15317888) has the molecular formula C25H31N5S and a molecular weight of 433.63 g/mol. Its IUPAC name is (3R,3aR,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide.
| Compound Name | (3R,3aR,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide |
|---|---|
| PubChem CID | 15317888 |
| Molecular Formula | C25H31N5S |
| Molecular Weight | 433.63 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (3R,3aR,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide |
| SMILES | CN(C)c1ccc(/C=C2\CCC[C@H]3C2=NN(C(N)=S)[C@H]3c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H31N5S/c1-28(2)20-12-8-17(9-13-20)16-19-6-5-7-22-23(19)27-30(25(26)31)24(22)18-10-14-21(15-11-18)29(3)4/h8-16,22,24H,5-7H2,1-4H3,(H2,26,31)/b19-16+/t22-,24-/m0/s1 |
| InChIKey | MVHSLZMRKZFDTM-PPIOEHGWSA-N |
| XLogP | 4.66 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|