C37H38ClN5O3S — CID 92853115
3-[(3S,3aS,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]-N-(4-chlorophenyl)benzenesulfonamide (PubChem CID 92853115) has the molecular formula C37H38ClN5O3S and a molecular weight of 668.26 g/mol. Its IUPAC name is 3-[(3S,3aS,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]-N-(4-chlorophenyl)benzenesulfonamide.
| Compound Name | 3-[(3S,3aS,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]-N-(4-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 92853115 |
| Molecular Formula | C37H38ClN5O3S |
| Molecular Weight | 668.26 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | 3-[(3S,3aS,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]-N-(4-chlorophenyl)benzenesulfonamide |
| SMILES | CN(C)c1ccc(/C=C2\CCC[C@@H]3C2=NN(C(=O)c2cccc(S(=O)(=O)Nc4ccc(Cl)cc4)c2)[C@@H]3c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H38ClN5O3S/c1-41(2)31-19-11-25(12-20-31)23-27-7-6-10-34-35(27)39-43(36(34)26-13-21-32(22-14-26)42(3)4)37(44)28-8-5-9-33(24-28)47(45,46)40-30-17-15-29(38)16-18-30/h5,8-9,11-24,34,36,40H,6-7,10H2,1-4H3/b27-23+/t34-,36-/m1/s1 |
| InChIKey | QVTDIRLIHNBIHW-QJNTYGNZSA-N |
| XLogP | 7.71 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.26 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|