C33H26ClN5O7S — CID 6156085
N-(4-chlorophenyl)-3-[(7Z)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]benzenesulfonamide (PubChem CID 6156085) has the molecular formula C33H26ClN5O7S and a molecular weight of 672.12 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[(7Z)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-3-[(7Z)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6156085 |
| Molecular Formula | C33H26ClN5O7S |
| Molecular Weight | 672.12 g/mol |
| Exact Mass | 671.12 |
| IUPAC Name | N-(4-chlorophenyl)-3-[(7Z)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]benzenesulfonamide |
| SMILES | O=C(c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)c1)N1N=C2/C(=C\c3cccc([N+](=O)[O-])c3)CCCC2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H26ClN5O7S/c34-25-13-15-26(16-14-25)36-47(45,46)29-11-3-8-24(20-29)33(40)37-32(23-7-2-10-28(19-23)39(43)44)30-12-4-6-22(31(30)35-37)17-21-5-1-9-27(18-21)38(41)42/h1-3,5,7-11,13-20,30,32,36H,4,6,12H2/b22-17- |
| InChIKey | ZYWWWHFAYPPQST-XLNRJJMWSA-N |
| XLogP | 7.39 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.12 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|