C31H31N3O7 — CID 3446619
[3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitrophenyl)methanone (PubChem CID 3446619) has the molecular formula C31H31N3O7 and a molecular weight of 557.60 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitrophenyl)methanone.
| Compound Name | [3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3446619 |
| Molecular Formula | C31H31N3O7 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitrophenyl)methanone |
| SMILES | COc1ccc(C=C2CCCC3C2=NN(C(=O)c2cccc([N+](=O)[O-])c2)C3c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C31H31N3O7/c1-38-25-13-11-19(16-27(25)40-3)15-20-7-6-10-24-29(20)32-33(31(35)22-8-5-9-23(17-22)34(36)37)30(24)21-12-14-26(39-2)28(18-21)41-4/h5,8-9,11-18,24,30H,6-7,10H2,1-4H3 |
| InChIKey | XBCKJXJJUQENJG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 112.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|