C25H20N4O6 — CID 51668950
[(3R,3aS,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(furan-2-yl)methanone (PubChem CID 51668950) has the molecular formula C25H20N4O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is [(3R,3aS,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(furan-2-yl)methanone.
| Compound Name | [(3R,3aS,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 51668950 |
| Molecular Formula | C25H20N4O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [(3R,3aS,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1N=C2/C(=C/c3cccc([N+](=O)[O-])c3)CCC[C@H]2[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20N4O6/c30-25(22-11-4-12-35-22)27-24(18-7-2-9-20(15-18)29(33)34)21-10-3-6-17(23(21)26-27)13-16-5-1-8-19(14-16)28(31)32/h1-2,4-5,7-9,11-15,21,24H,3,6,10H2/b17-13+/t21-,24+/m1/s1 |
| InChIKey | ODAXEJLETUYBIE-KLLTYKNHSA-N |
| XLogP | 5.53 |
| TPSA | 132.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|