C26H23ClN6O5 — CID 40737895
[(3R,3aS,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-1-ethylpyrazol-3-yl)methanone (PubChem CID 40737895) has the molecular formula C26H23ClN6O5 and a molecular weight of 534.96 g/mol. Its IUPAC name is [(3R,3aS,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-1-ethylpyrazol-3-yl)methanone.
| Compound Name | [(3R,3aS,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-1-ethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 40737895 |
| Molecular Formula | C26H23ClN6O5 |
| Molecular Weight | 534.96 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | [(3R,3aS,7E)-3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-1-ethylpyrazol-3-yl)methanone |
| SMILES | CCn1cc(Cl)c(C(=O)N2N=C3/C(=C/c4cccc([N+](=O)[O-])c4)CCC[C@H]3[C@@H]2c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C26H23ClN6O5/c1-2-30-15-22(27)24(28-30)26(34)31-25(18-8-4-10-20(14-18)33(37)38)21-11-5-7-17(23(21)29-31)12-16-6-3-9-19(13-16)32(35)36/h3-4,6,8-10,12-15,21,25H,2,5,7,11H2,1H3/b17-12+/t21-,25+/m1/s1 |
| InChIKey | MKHOQEPBUQNZRU-FUSANKIHSA-N |
| XLogP | 5.81 |
| TPSA | 136.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.96 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|