C28H23FN4O6 — CID 4108143
2-(2-fluorophenoxy)-1-[3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone (PubChem CID 4108143) has the molecular formula C28H23FN4O6 and a molecular weight of 530.51 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-1-[3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone.
| Compound Name | 2-(2-fluorophenoxy)-1-[3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone |
|---|---|
| PubChem CID | 4108143 |
| Molecular Formula | C28H23FN4O6 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 2-(2-fluorophenoxy)-1-[3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethanone |
| SMILES | O=C(COc1ccccc1F)N1N=C2C(=Cc3cccc([N+](=O)[O-])c3)CCCC2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23FN4O6/c29-24-12-1-2-13-25(24)39-17-26(34)31-28(20-8-4-10-22(16-20)33(37)38)23-11-5-7-19(27(23)30-31)14-18-6-3-9-21(15-18)32(35)36/h1-4,6,8-10,12-16,23,28H,5,7,11,17H2 |
| InChIKey | CUGWAOBSKLDCJW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|