C32H33FN2O4 — CID 25318506
1-[(3S,3aR,7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone (PubChem CID 25318506) has the molecular formula C32H33FN2O4 and a molecular weight of 528.62 g/mol. Its IUPAC name is 1-[(3S,3aR,7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone.
| Compound Name | 1-[(3S,3aR,7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 25318506 |
| Molecular Formula | C32H33FN2O4 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 1-[(3S,3aR,7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone |
| SMILES | CCOc1ccc(/C=C2\CCC[C@H]3C2=NN(C(=O)COc2ccccc2F)[C@@H]3c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C32H33FN2O4/c1-3-37-25-16-12-22(13-17-25)20-24-8-7-9-27-31(24)34-35(30(36)21-39-29-11-6-5-10-28(29)33)32(27)23-14-18-26(19-15-23)38-4-2/h5-6,10-20,27,32H,3-4,7-9,21H2,1-2H3/b24-20+/t27-,32+/m0/s1 |
| InChIKey | DANJKGOKWJURAC-VLWGIRJOSA-N |
| XLogP | 6.83 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |