C30H29FN2O4 — CID 92956341
1-[(3S,3aR,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone (PubChem CID 92956341) has the molecular formula C30H29FN2O4 and a molecular weight of 500.57 g/mol. Its IUPAC name is 1-[(3S,3aR,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone.
| Compound Name | 1-[(3S,3aR,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 92956341 |
| Molecular Formula | C30H29FN2O4 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 1-[(3S,3aR,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone |
| SMILES | COc1ccc(/C=C2/CCC[C@H]3C2=NN(C(=O)COc2ccccc2F)[C@@H]3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H29FN2O4/c1-35-23-14-10-20(11-15-23)18-22-6-5-7-25-29(22)32-33(30(25)21-12-16-24(36-2)17-13-21)28(34)19-37-27-9-4-3-8-26(27)31/h3-4,8-18,25,30H,5-7,19H2,1-2H3/b22-18-/t25-,30+/m0/s1 |
| InChIKey | NLMHDTJIFNMAQZ-GPVNROKBSA-N |
| XLogP | 6.04 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |