C24H21FN2O2S2 — CID 26857347
1-[(3S,3aS,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone (PubChem CID 26857347) has the molecular formula C24H21FN2O2S2 and a molecular weight of 452.58 g/mol. Its IUPAC name is 1-[(3S,3aS,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone.
| Compound Name | 1-[(3S,3aS,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 26857347 |
| Molecular Formula | C24H21FN2O2S2 |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-[(3S,3aS,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(2-fluorophenoxy)ethanone |
| SMILES | O=C(COc1ccccc1F)N1N=C2/C(=C/c3cccs3)CCC[C@H]2[C@H]1c1cccs1 |
| InChI | InChI=1S/C24H21FN2O2S2/c25-19-9-1-2-10-20(19)29-15-22(28)27-24(21-11-5-13-31-21)18-8-3-6-16(23(18)26-27)14-17-7-4-12-30-17/h1-2,4-5,7,9-14,18,24H,3,6,8,15H2/b16-14+/t18-,24+/m1/s1 |
| InChIKey | YHXRHIJYBLKGKK-PABCSEEXSA-N |
| XLogP | 6.15 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |