C26H25N3O3S2 — CID 6377517
2-[2-oxo-2-[(7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 6377517) has the molecular formula C26H25N3O3S2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 2-[2-oxo-2-[(7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[2-oxo-2-[(7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6377517 |
| Molecular Formula | C26H25N3O3S2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-[2-oxo-2-[(7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]ethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1CC(=O)N1N=C2/C(=C\c3cccs3)CCCC2C1c1cccs1 |
| InChI | InChI=1S/C26H25N3O3S2/c30-22(15-28-25(31)18-8-1-2-9-19(18)26(28)32)29-24(21-11-5-13-34-21)20-10-3-6-16(23(20)27-29)14-17-7-4-12-33-17/h1-2,4-5,7,11-14,18-20,24H,3,6,8-10,15H2/b16-14- |
| InChIKey | MQBBGRRWJQFSMN-PEZBUJJGSA-N |
| XLogP | 4.88 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|