C24H29N3OS2 — CID 99100066
1-[(3R,3aR,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[(3R)-3-methylpiperidin-1-yl]ethanone (PubChem CID 99100066) has the molecular formula C24H29N3OS2 and a molecular weight of 439.65 g/mol. Its IUPAC name is 1-[(3R,3aR,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[(3R)-3-methylpiperidin-1-yl]ethanone.
| Compound Name | 1-[(3R,3aR,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[(3R)-3-methylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 99100066 |
| Molecular Formula | C24H29N3OS2 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1-[(3R,3aR,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[(3R)-3-methylpiperidin-1-yl]ethanone |
| SMILES | C[C@@H]1CCCN(CC(=O)N2N=C3/C(=C/c4cccs4)CCC[C@@H]3[C@@H]2c2cccs2)C1 |
| InChI | InChI=1S/C24H29N3OS2/c1-17-6-3-11-26(15-17)16-22(28)27-24(21-10-5-13-30-21)20-9-2-7-18(23(20)25-27)14-19-8-4-12-29-19/h4-5,8,10,12-14,17,20,24H,2-3,6-7,9,11,15-16H2,1H3/b18-14+/t17-,20+,24-/m1/s1 |
| InChIKey | MZIWRSXHNVMYEY-APRZANMYSA-N |
| XLogP | 5.66 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |