C28H34N4O3S2 — CID 99098375
(5R)-3-[2-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-hexyl-5-methylimidazolidine-2,4-dione (PubChem CID 99098375) has the molecular formula C28H34N4O3S2 and a molecular weight of 538.74 g/mol. Its IUPAC name is (5R)-3-[2-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-hexyl-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-hexyl-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 99098375 |
| Molecular Formula | C28H34N4O3S2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (5R)-3-[2-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl]-5-hexyl-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCCC[C@@]1(C)NC(=O)N(CC(=O)N2N=C3/C(=C\c4cccs4)CCC[C@@H]3[C@@H]2c2cccs2)C1=O |
| InChI | InChI=1S/C28H34N4O3S2/c1-3-4-5-6-14-28(2)26(34)31(27(35)29-28)18-23(33)32-25(22-13-9-16-37-22)21-12-7-10-19(24(21)30-32)17-20-11-8-15-36-20/h8-9,11,13,15-17,21,25H,3-7,10,12,14,18H2,1-2H3,(H,29,35)/b19-17-/t21-,25+,28+/m0/s1 |
| InChIKey | SICGCCPYAUHDKQ-XHKNGKCPSA-N |
| XLogP | 6.21 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|