C22H22N6OS3 — CID 100863128
1-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylethanone (PubChem CID 100863128) has the molecular formula C22H22N6OS3 and a molecular weight of 482.66 g/mol. Its IUPAC name is 1-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylethanone.
| Compound Name | 1-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylethanone |
|---|---|
| PubChem CID | 100863128 |
| Molecular Formula | C22H22N6OS3 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 1-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylethanone |
| SMILES | Nc1cc(N)nc(SCC(=O)N2N=C3/C(=C\c4cccs4)CCC[C@@H]3[C@@H]2c2cccs2)n1 |
| InChI | InChI=1S/C22H22N6OS3/c23-17-11-18(24)26-22(25-17)32-12-19(29)28-21(16-7-3-9-31-16)15-6-1-4-13(20(15)27-28)10-14-5-2-8-30-14/h2-3,5,7-11,15,21H,1,4,6,12H2,(H4,23,24,25,26)/b13-10-/t15-,21+/m0/s1 |
| InChIKey | YBEVJXKTFPXSJC-ATOKPLOQSA-N |
| XLogP | 4.68 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |