C28H30N2O4S2 — CID 100851317
[2-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 100851317) has the molecular formula C28H30N2O4S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is [2-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | [2-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 100851317 |
| Molecular Formula | C28H30N2O4S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | [2-[(3R,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] (1R,5S)-9-oxobicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | O=C(OCC(=O)N1N=C2/C(=C\c3cccs3)CCC[C@@H]2[C@@H]1c1cccs1)C1C[C@H]2CCC[C@@H](C1)C2=O |
| InChI | InChI=1S/C28H30N2O4S2/c31-24(16-34-28(33)20-13-18-6-1-7-19(14-20)27(18)32)30-26(23-10-4-12-36-23)22-9-2-5-17(25(22)29-30)15-21-8-3-11-35-21/h3-4,8,10-12,15,18-20,22,26H,1-2,5-7,9,13-14,16H2/b17-15-/t18-,19+,20?,22-,26+/m0/s1 |
| InChIKey | DYQBLIMWKISNNJ-OVZHNCBPSA-N |
| XLogP | 5.87 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |