C30H29FN2O3S2 — CID 99845706
[2-[(3S,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 1-(3-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 99845706) has the molecular formula C30H29FN2O3S2 and a molecular weight of 548.71 g/mol. Its IUPAC name is [2-[(3S,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 1-(3-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-[(3S,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 1-(3-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 99845706 |
| Molecular Formula | C30H29FN2O3S2 |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | [2-[(3S,3aR,7Z)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 1-(3-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2cccc(F)c2)CCCC1)N1N=C2/C(=C\c3cccs3)CCC[C@@H]2[C@H]1c1cccs1 |
| InChI | InChI=1S/C30H29FN2O3S2/c31-22-9-4-8-21(18-22)30(13-1-2-14-30)29(35)36-19-26(34)33-28(25-12-6-16-38-25)24-11-3-7-20(27(24)32-33)17-23-10-5-15-37-23/h4-6,8-10,12,15-18,24,28H,1-3,7,11,13-14,19H2/b20-17-/t24-,28-/m0/s1 |
| InChIKey | QYSJSROJINFBMD-JFFNHNPXSA-N |
| XLogP | 7.13 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |