C32H25N3OS2 — CID 129379237
[(3S,3aR,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2-phenylquinolin-4-yl)methanone (PubChem CID 129379237) has the molecular formula C32H25N3OS2 and a molecular weight of 531.71 g/mol. Its IUPAC name is [(3S,3aR,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2-phenylquinolin-4-yl)methanone.
| Compound Name | [(3S,3aR,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2-phenylquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 129379237 |
| Molecular Formula | C32H25N3OS2 |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | [(3S,3aR,7E)-3-thiophen-2-yl-7-(thiophen-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2-phenylquinolin-4-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)nc2ccccc12)N1N=C2/C(=C/c3cccs3)CCC[C@@H]2[C@H]1c1cccs1 |
| InChI | InChI=1S/C32H25N3OS2/c36-32(26-20-28(21-9-2-1-3-10-21)33-27-15-5-4-13-24(26)27)35-31(29-16-8-18-38-29)25-14-6-11-22(30(25)34-35)19-23-12-7-17-37-23/h1-5,7-10,12-13,15-20,25,31H,6,11,14H2/b22-19+/t25-,31-/m0/s1 |
| InChIKey | HVGGYLHLJPRFAX-GMRSJOOMSA-N |
| XLogP | 8.46 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |