C31H31N3O5 — CID 92833229
[(3S,3aS,7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitrophenyl)methanone (PubChem CID 92833229) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is [(3S,3aS,7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitrophenyl)methanone.
| Compound Name | [(3S,3aS,7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 92833229 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | [(3S,3aS,7E)-3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitrophenyl)methanone |
| SMILES | CCOc1ccc(/C=C2\CCC[C@@H]3C2=NN(C(=O)c2cccc([N+](=O)[O-])c2)[C@@H]3c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C31H31N3O5/c1-3-38-26-15-11-21(12-16-26)19-23-7-6-10-28-29(23)32-33(30(28)22-13-17-27(18-14-22)39-4-2)31(35)24-8-5-9-25(20-24)34(36)37/h5,8-9,11-20,28,30H,3-4,6-7,10H2,1-2H3/b23-19+/t28-,30-/m1/s1 |
| InChIKey | NCYAPHHETCAVGP-GCOOMIHPSA-N |
| XLogP | 6.83 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|