C35H38N4O6 — CID 3436000
[3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2-morpholin-4-yl-5-nitrophenyl)methanone (PubChem CID 3436000) has the molecular formula C35H38N4O6 and a molecular weight of 610.71 g/mol. Its IUPAC name is [3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2-morpholin-4-yl-5-nitrophenyl)methanone.
| Compound Name | [3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2-morpholin-4-yl-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3436000 |
| Molecular Formula | C35H38N4O6 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | [3-(4-ethoxyphenyl)-7-[(4-ethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2-morpholin-4-yl-5-nitrophenyl)methanone |
| SMILES | CCOc1ccc(C=C2CCCC3C2=NN(C(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)C3c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C35H38N4O6/c1-3-44-28-13-8-24(9-14-28)22-26-6-5-7-30-33(26)36-38(34(30)25-10-15-29(16-11-25)45-4-2)35(40)31-23-27(39(41)42)12-17-32(31)37-18-20-43-21-19-37/h8-17,22-23,30,34H,3-7,18-21H2,1-2H3 |
| InChIKey | OMOKKGZHHSVWMZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|