C31H32ClN5O3 — CID 6107758
(2-chloro-5-nitrophenyl)-[(7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone (PubChem CID 6107758) has the molecular formula C31H32ClN5O3 and a molecular weight of 558.08 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)-[(7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone.
| Compound Name | (2-chloro-5-nitrophenyl)-[(7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone |
|---|---|
| PubChem CID | 6107758 |
| Molecular Formula | C31H32ClN5O3 |
| Molecular Weight | 558.08 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | (2-chloro-5-nitrophenyl)-[(7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone |
| SMILES | CN(C)c1ccc(/C=C2\CCCC3C2=NN(C(=O)c2cc([N+](=O)[O-])ccc2Cl)C3c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H32ClN5O3/c1-34(2)23-12-8-20(9-13-23)18-22-6-5-7-26-29(22)33-36(30(26)21-10-14-24(15-11-21)35(3)4)31(38)27-19-25(37(39)40)16-17-28(27)32/h8-19,26,30H,5-7H2,1-4H3/b22-18+ |
| InChIKey | TYJLORYUTFELOJ-RELWKKBWSA-N |
| XLogP | 6.82 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.08 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|