C27H20Br2ClN3O3 — CID 97354594
[(3S,3aR,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-3-nitrophenyl)methanone (PubChem CID 97354594) has the molecular formula C27H20Br2ClN3O3 and a molecular weight of 629.74 g/mol. Its IUPAC name is [(3S,3aR,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-3-nitrophenyl)methanone.
| Compound Name | [(3S,3aR,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 97354594 |
| Molecular Formula | C27H20Br2ClN3O3 |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 626.96 |
| IUPAC Name | [(3S,3aR,7Z)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1N=C2/C(=C\c3ccc(Br)cc3)CCC[C@@H]2[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H20Br2ClN3O3/c28-20-9-4-16(5-10-20)14-18-2-1-3-22-25(18)31-32(26(22)17-6-11-21(29)12-7-17)27(34)19-8-13-23(30)24(15-19)33(35)36/h4-15,22,26H,1-3H2/b18-14-/t22-,26+/m0/s1 |
| InChIKey | ZDNBRCBWQVHZMF-UCNGGQBMSA-N |
| XLogP | 8.21 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|