C31H28ClN3O7 — CID 23963024
[2-[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 23963024) has the molecular formula C31H28ClN3O7 and a molecular weight of 590.03 g/mol. Its IUPAC name is [2-[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 23963024 |
| Molecular Formula | C31H28ClN3O7 |
| Molecular Weight | 590.03 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | [2-[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | COc1ccc(C=C2CCCC3C2=NN(C(=O)COC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H28ClN3O7/c1-40-23-11-6-19(7-12-23)16-21-4-3-5-25-29(21)33-34(30(25)20-8-13-24(41-2)14-9-20)28(36)18-42-31(37)22-10-15-26(32)27(17-22)35(38)39/h6-17,25,30H,3-5,18H2,1-2H3 |
| InChIKey | APNFOXSVYQBRFO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 120.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.03 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|