C36H36Cl2N4O5 — CID 166181947
[2-[(7Z)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 166181947) has the molecular formula C36H36Cl2N4O5 and a molecular weight of 675.61 g/mol. Its IUPAC name is [2-[(7Z)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-[(7Z)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 166181947 |
| Molecular Formula | C36H36Cl2N4O5 |
| Molecular Weight | 675.61 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | [2-[(7Z)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)OCC(=O)N3N=C4/C(=C\c5ccc(Cl)cc5)CCCC4C3c3ccc(Cl)cc3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C36H36Cl2N4O5/c1-22-16-23(2)20-40(19-22)31-15-10-27(18-32(31)42(45)46)36(44)47-21-33(43)41-35(25-8-13-29(38)14-9-25)30-5-3-4-26(34(30)39-41)17-24-6-11-28(37)12-7-24/h6-15,17-18,22-23,30,35H,3-5,16,19-21H2,1-2H3/b26-17- |
| InChIKey | UJBGCWJWVUNYLP-ONUIUJJFSA-N |
| XLogP | 8.36 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.61 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|