C35H38N4O7 — CID 98494240
[(3R,3aR,7Z)-3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone (PubChem CID 98494240) has the molecular formula C35H38N4O7 and a molecular weight of 626.71 g/mol. Its IUPAC name is [(3R,3aR,7Z)-3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | [(3R,3aR,7Z)-3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 98494240 |
| Molecular Formula | C35H38N4O7 |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | [(3R,3aR,7Z)-3-(3,4-dimethoxyphenyl)-7-[(3,4-dimethoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone |
| SMILES | COc1ccc(/C=C2/CCC[C@H]3C2=NN(C(=O)c2ccc(N4CCCC4)c([N+](=O)[O-])c2)[C@H]3c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C35H38N4O7/c1-43-29-14-10-22(19-31(29)45-3)18-23-8-7-9-26-33(23)36-38(34(26)24-12-15-30(44-2)32(21-24)46-4)35(40)25-11-13-27(28(20-25)39(41)42)37-16-5-6-17-37/h10-15,18-21,26,34H,5-9,16-17H2,1-4H3/b23-18-/t26-,34-/m0/s1 |
| InChIKey | JFFXOTLGVJYQIL-OTKFODQVSA-N |
| XLogP | 6.67 |
| TPSA | 115.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|