C33H30N4O8 — CID 98392487
[(3R,3aS,7E)-3-(1,3-benzodioxol-5-yl)-7-(1,3-benzodioxol-5-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 98392487) has the molecular formula C33H30N4O8 and a molecular weight of 610.62 g/mol. Its IUPAC name is [(3R,3aS,7E)-3-(1,3-benzodioxol-5-yl)-7-(1,3-benzodioxol-5-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [(3R,3aS,7E)-3-(1,3-benzodioxol-5-yl)-7-(1,3-benzodioxol-5-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 98392487 |
| Molecular Formula | C33H30N4O8 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | [(3R,3aS,7E)-3-(1,3-benzodioxol-5-yl)-7-(1,3-benzodioxol-5-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)N1N=C2/C(=C/c3ccc4c(c3)OCO4)CCC[C@H]2[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C33H30N4O8/c38-33(23-5-7-25(26(16-23)37(39)40)35-10-12-41-13-11-35)36-32(22-6-9-28-30(17-22)45-19-43-28)24-3-1-2-21(31(24)34-36)14-20-4-8-27-29(15-20)44-18-42-27/h4-9,14-17,24,32H,1-3,10-13,18-19H2/b21-14+/t24-,32+/m1/s1 |
| InChIKey | VXGNXCVRIIXHSM-GBVNUPCTSA-N |
| XLogP | 5.33 |
| TPSA | 125.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|