C29H26ClN3O5 — CID 4097267
(4-chloro-3-nitrophenyl)-[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone (PubChem CID 4097267) has the molecular formula C29H26ClN3O5 and a molecular weight of 532.00 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl)-[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone.
| Compound Name | (4-chloro-3-nitrophenyl)-[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone |
|---|---|
| PubChem CID | 4097267 |
| Molecular Formula | C29H26ClN3O5 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone |
| SMILES | COc1ccc(C=C2CCCC3C2=NN(C(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H26ClN3O5/c1-37-22-11-6-18(7-12-22)16-20-4-3-5-24-27(20)31-32(28(24)19-8-13-23(38-2)14-9-19)29(34)21-10-15-25(30)26(17-21)33(35)36/h6-17,24,28H,3-5H2,1-2H3 |
| InChIKey | HOIUIKFGAALZBD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|