C27H22ClN3O3 — CID 6147333
[(7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-3-nitrophenyl)methanone (PubChem CID 6147333) has the molecular formula C27H22ClN3O3 and a molecular weight of 471.94 g/mol. Its IUPAC name is [(7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-3-nitrophenyl)methanone.
| Compound Name | [(7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 6147333 |
| Molecular Formula | C27H22ClN3O3 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [(7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c([N+](=O)[O-])c1)N1N=C2/C(=C\c3ccccc3)CCCC2C1c1ccccc1 |
| InChI | InChI=1S/C27H22ClN3O3/c28-23-15-14-21(17-24(23)31(33)34)27(32)30-26(19-10-5-2-6-11-19)22-13-7-12-20(25(22)29-30)16-18-8-3-1-4-9-18/h1-6,8-11,14-17,22,26H,7,12-13H2/b20-16- |
| InChIKey | OICFMWBDNMEDPC-SILNSSARSA-N |
| XLogP | 6.68 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|