C28H23N3O5 — CID 25358661
2-[(3R,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]-6-nitrobenzoic acid (PubChem CID 25358661) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[(3R,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]-6-nitrobenzoic acid.
| Compound Name | 2-[(3R,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 25358661 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[(3R,3aR,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbonyl]-6-nitrobenzoic acid |
| SMILES | O=C(O)c1c(C(=O)N2N=C3/C(=C/c4ccccc4)CCC[C@@H]3[C@@H]2c2ccccc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H23N3O5/c32-27(21-14-8-16-23(31(35)36)24(21)28(33)34)30-26(19-11-5-2-6-12-19)22-15-7-13-20(25(22)29-30)17-18-9-3-1-4-10-18/h1-6,8-12,14,16-17,22,26H,7,13,15H2,(H,33,34)/b20-17+/t22-,26-/m0/s1 |
| InChIKey | SLQDOJHPBKTUGO-JYSRXCGNSA-N |
| XLogP | 5.73 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|