C29H23F2N3O5 — CID 23990588
[2-[3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 2-nitrobenzoate (PubChem CID 23990588) has the molecular formula C29H23F2N3O5 and a molecular weight of 531.52 g/mol. Its IUPAC name is [2-[3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 2-nitrobenzoate.
| Compound Name | [2-[3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 23990588 |
| Molecular Formula | C29H23F2N3O5 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | [2-[3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 2-nitrobenzoate |
| SMILES | O=C(OCC(=O)N1N=C2C(=Cc3ccc(F)cc3)CCCC2C1c1ccc(F)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C29H23F2N3O5/c30-21-12-8-18(9-13-21)16-20-4-3-6-24-27(20)32-33(28(24)19-10-14-22(31)15-11-19)26(35)17-39-29(36)23-5-1-2-7-25(23)34(37)38/h1-2,5,7-16,24,28H,3-4,6,17H2 |
| InChIKey | FRNRJUZEADOYJD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|