C27H20F4N2O — CID 51982652
[(3R,3aR,7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 51982652) has the molecular formula C27H20F4N2O and a molecular weight of 464.46 g/mol. Its IUPAC name is [(3R,3aR,7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | [(3R,3aR,7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 51982652 |
| Molecular Formula | C27H20F4N2O |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [(3R,3aR,7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)N1N=C2/C(=C\c3ccccc3)CCC[C@@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H20F4N2O/c28-21-15-20(22(29)24(31)23(21)30)27(34)33-26(17-10-5-2-6-11-17)19-13-7-12-18(25(19)32-33)14-16-8-3-1-4-9-16/h1-6,8-11,14-15,19,26H,7,12-13H2/b18-14-/t19-,26-/m0/s1 |
| InChIKey | OEEMHTKZNBDQSK-YVRINPPYSA-N |
| XLogP | 6.68 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|