C31H30N4O4 — CID 93475743
[(3S,3aS,7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 93475743) has the molecular formula C31H30N4O4 and a molecular weight of 522.61 g/mol. Its IUPAC name is [(3S,3aS,7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [(3S,3aS,7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 93475743 |
| Molecular Formula | C31H30N4O4 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | [(3S,3aS,7Z)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)N1N=C2/C(=C\c3ccccc3)CCC[C@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H30N4O4/c36-31(25-14-15-27(28(21-25)35(37)38)33-16-18-39-19-17-33)34-30(23-10-5-2-6-11-23)26-13-7-12-24(29(26)32-34)20-22-8-3-1-4-9-22/h1-6,8-11,14-15,20-21,26,30H,7,12-13,16-19H2/b24-20-/t26-,30-/m1/s1 |
| InChIKey | HXVRMIWYMBDCEM-KKBLXHKSSA-N |
| XLogP | 5.87 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|