C33H34N4O6 — CID 3429317
[3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 3429317) has the molecular formula C33H34N4O6 and a molecular weight of 582.66 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3429317 |
| Molecular Formula | C33H34N4O6 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | [3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | COc1ccc(C=C2CCCC3C2=NN(C(=O)c2ccc(N4CCOCC4)c([N+](=O)[O-])c2)C3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H34N4O6/c1-41-26-11-6-22(7-12-26)20-24-4-3-5-28-31(24)34-36(32(28)23-8-13-27(42-2)14-9-23)33(38)25-10-15-29(30(21-25)37(39)40)35-16-18-43-19-17-35/h6-15,20-21,28,32H,3-5,16-19H2,1-2H3 |
| InChIKey | PNLLOSCXBMKJBK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|