C28H25N5O7 — CID 40737868
[(3R,3aR,7E)-3-(1,3-benzodioxol-5-yl)-7-(1,3-benzodioxol-5-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone (PubChem CID 40737868) has the molecular formula C28H25N5O7 and a molecular weight of 543.54 g/mol. Its IUPAC name is [(3R,3aR,7E)-3-(1,3-benzodioxol-5-yl)-7-(1,3-benzodioxol-5-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone.
| Compound Name | [(3R,3aR,7E)-3-(1,3-benzodioxol-5-yl)-7-(1,3-benzodioxol-5-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 40737868 |
| Molecular Formula | C28H25N5O7 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | [(3R,3aR,7E)-3-(1,3-benzodioxol-5-yl)-7-(1,3-benzodioxol-5-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)N2N=C3/C(=C/c4ccc5c(c4)OCO5)CCC[C@@H]3[C@@H]2c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C28H25N5O7/c1-2-31-13-20(33(35)36)26(29-31)28(34)32-27(18-7-9-22-24(12-18)40-15-38-22)19-5-3-4-17(25(19)30-32)10-16-6-8-21-23(11-16)39-14-37-21/h6-13,19,27H,2-5,14-15H2,1H3/b17-10+/t19-,27-/m0/s1 |
| InChIKey | BVADIOQNARLZOG-OEQPYECZSA-N |
| XLogP | 4.71 |
| TPSA | 130.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|