C29H28N4O5 — CID 92956130
[2-[(3S,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 92956130) has the molecular formula C29H28N4O5 and a molecular weight of 512.57 g/mol. Its IUPAC name is [2-[(3S,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[(3S,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 92956130 |
| Molecular Formula | C29H28N4O5 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | [2-[(3S,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | COc1ccc(/C=C2/CCC[C@@H]3C2=NN(C(=O)COC(=O)c2cnccn2)[C@@H]3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H28N4O5/c1-36-22-10-6-19(7-11-22)16-21-4-3-5-24-27(21)32-33(28(24)20-8-12-23(37-2)13-9-20)26(34)18-38-29(35)25-17-30-14-15-31-25/h6-17,24,28H,3-5,18H2,1-2H3/b21-16-/t24-,28-/m1/s1 |
| InChIKey | UBLGZBADBWGGOJ-QJSZAAJMSA-N |
| XLogP | 4.47 |
| TPSA | 103.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |