C29H30Cl2N2O5 — CID 98408527
[2-[(3S,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 98408527) has the molecular formula C29H30Cl2N2O5 and a molecular weight of 557.47 g/mol. Its IUPAC name is [2-[(3S,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-[(3S,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 98408527 |
| Molecular Formula | C29H30Cl2N2O5 |
| Molecular Weight | 557.47 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | [2-[(3S,3aS,7Z)-3-(4-methoxyphenyl)-7-[(4-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | COc1ccc(/C=C2/CCC[C@@H]3C2=NN(C(=O)COC(=O)[C@]2(C)CC2(Cl)Cl)[C@@H]3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H30Cl2N2O5/c1-28(17-29(28,30)31)27(35)38-16-24(34)33-26(19-9-13-22(37-3)14-10-19)23-6-4-5-20(25(23)32-33)15-18-7-11-21(36-2)12-8-18/h7-15,23,26H,4-6,16-17H2,1-3H3/b20-15-/t23-,26-,28+/m1/s1 |
| InChIKey | DTCBCVOSVOWRIO-AKNORFNSSA-N |
| XLogP | 5.95 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|