C23H18N4O7 — CID 4557325
(3,5-dinitrophenyl)-[3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone (PubChem CID 4557325) has the molecular formula C23H18N4O7 and a molecular weight of 462.42 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-[3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone.
| Compound Name | (3,5-dinitrophenyl)-[3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone |
|---|---|
| PubChem CID | 4557325 |
| Molecular Formula | C23H18N4O7 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (3,5-dinitrophenyl)-[3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N1N=C2C(=Cc3ccco3)CCCC2C1c1ccco1 |
| InChI | InChI=1S/C23H18N4O7/c28-23(15-10-16(26(29)30)13-17(11-15)27(31)32)25-22(20-7-3-9-34-20)19-6-1-4-14(21(19)24-25)12-18-5-2-8-33-18/h2-3,5,7-13,19,22H,1,4,6H2 |
| InChIKey | NBMXAGJZVUEAEY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 145.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|