C25H21N3O7 — CID 3593143
[2-[3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 3-nitrobenzoate (PubChem CID 3593143) has the molecular formula C25H21N3O7 and a molecular weight of 475.46 g/mol. Its IUPAC name is [2-[3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-[3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 3593143 |
| Molecular Formula | C25H21N3O7 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | [2-[3-(furan-2-yl)-7-(furan-2-ylmethylidene)-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-oxoethyl] 3-nitrobenzoate |
| SMILES | O=C(OCC(=O)N1N=C2C(=Cc3ccco3)CCCC2C1c1ccco1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21N3O7/c29-22(15-35-25(30)17-6-1-7-18(13-17)28(31)32)27-24(21-10-4-12-34-21)20-9-2-5-16(23(20)26-27)14-19-8-3-11-33-19/h1,3-4,6-8,10-14,20,24H,2,5,9,15H2 |
| InChIKey | WCXXQRNMLPSGFV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 128.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|