C31H35F3N6O — CID 40736035
1-[(3S,3aR,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone (PubChem CID 40736035) has the molecular formula C31H35F3N6O and a molecular weight of 564.66 g/mol. Its IUPAC name is 1-[(3S,3aR,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[(3S,3aR,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 40736035 |
| Molecular Formula | C31H35F3N6O |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 1-[(3S,3aR,7E)-3-[4-(dimethylamino)phenyl]-7-[[4-(dimethylamino)phenyl]methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-2-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
| SMILES | Cc1cc(C(F)(F)F)nn1CC(=O)N1N=C2/C(=C/c3ccc(N(C)C)cc3)CCC[C@@H]2[C@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C31H35F3N6O/c1-20-17-27(31(32,33)34)35-39(20)19-28(41)40-30(22-11-15-25(16-12-22)38(4)5)26-8-6-7-23(29(26)36-40)18-21-9-13-24(14-10-21)37(2)3/h9-18,26,30H,6-8,19H2,1-5H3/b23-18+/t26-,30+/m0/s1 |
| InChIKey | FBRXBANJMIRPCT-AAXCFMIESA-N |
| XLogP | 6.17 |
| TPSA | 56.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|