C26H21Cl2N3O — CID 40733184
[(3R,3aR,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-pyridin-3-ylmethanone (PubChem CID 40733184) has the molecular formula C26H21Cl2N3O and a molecular weight of 462.38 g/mol. Its IUPAC name is [(3R,3aR,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-pyridin-3-ylmethanone.
| Compound Name | [(3R,3aR,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 40733184 |
| Molecular Formula | C26H21Cl2N3O |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | [(3R,3aR,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1N=C2/C(=C/c3ccc(Cl)cc3)CCC[C@@H]2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21Cl2N3O/c27-21-10-6-17(7-11-21)15-19-3-1-5-23-24(19)30-31(26(32)20-4-2-14-29-16-20)25(23)18-8-12-22(28)13-9-18/h2,4,6-16,23,25H,1,3,5H2/b19-15+/t23-,25-/m0/s1 |
| InChIKey | DREAZDBEZRPZSW-JNLFVNFDSA-N |
| XLogP | 6.83 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |