C27H25N3S — CID 6379895
(7Z)-7-benzylidene-N,3-diphenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide (PubChem CID 6379895) has the molecular formula C27H25N3S and a molecular weight of 423.59 g/mol. Its IUPAC name is (7Z)-7-benzylidene-N,3-diphenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide.
| Compound Name | (7Z)-7-benzylidene-N,3-diphenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide |
|---|---|
| PubChem CID | 6379895 |
| Molecular Formula | C27H25N3S |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (7Z)-7-benzylidene-N,3-diphenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1N=C2/C(=C\c3ccccc3)CCCC2C1c1ccccc1 |
| InChI | InChI=1S/C27H25N3S/c31-27(28-23-16-8-3-9-17-23)30-26(21-13-6-2-7-14-21)24-18-10-15-22(25(24)29-30)19-20-11-4-1-5-12-20/h1-9,11-14,16-17,19,24,26H,10,15,18H2,(H,28,31)/b22-19- |
| InChIKey | KZBAMOIOGRXNBO-QOCHGBHMSA-N |
| XLogP | 6.68 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|