C24H26BrN3S — CID 10838005
[(3S,3aS,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioyl]-prop-2-enylazanium bromide (PubChem CID 10838005) has the molecular formula C24H26BrN3S and a molecular weight of 468.46 g/mol. Its IUPAC name is [(3S,3aS,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioyl]-prop-2-enylazanium bromide.
| Compound Name | [(3S,3aS,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioyl]-prop-2-enylazanium bromide |
|---|---|
| PubChem CID | 10838005 |
| Molecular Formula | C24H26BrN3S |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | [(3S,3aS,7E)-7-benzylidene-3-phenyl-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioyl]-prop-2-enylazanium bromide |
| SMILES | C=CC[NH2+]C(=S)N1N=C2/C(=C/c3ccccc3)CCC[C@H]2[C@H]1c1ccccc1.[Br-] |
| InChI | InChI=1S/C24H25N3S.BrH/c1-2-16-25-24(28)27-23(19-12-7-4-8-13-19)21-15-9-14-20(22(21)26-27)17-18-10-5-3-6-11-18;/h2-8,10-13,17,21,23H,1,9,14-16H2,(H,25,28);1H/b20-17+;/t21-,23-;/m1./s1 |
| InChIKey | XCEUIGCHWCUEOQ-ZOMMLEEUSA-N |
| XLogP | 1.32 |
| TPSA | 32.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|