C20H21ClNO+ — CID 7042649
[(1S)-3-benzylidene-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylazanium (PubChem CID 7042649) has the molecular formula C20H21ClNO+ and a molecular weight of 326.85 g/mol. Its IUPAC name is [(1S)-3-benzylidene-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylazanium.
| Compound Name | [(1S)-3-benzylidene-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylazanium |
|---|---|
| PubChem CID | 7042649 |
| Molecular Formula | C20H21ClNO+ |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | [(1S)-3-benzylidene-1-(2-chlorophenyl)-2-oxocyclohexyl]-methylazanium |
| SMILES | C[NH2+][C@]1(c2ccccc2Cl)CCCC(=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H20ClNO/c1-22-20(17-11-5-6-12-18(17)21)13-7-10-16(19(20)23)14-15-8-3-2-4-9-15/h2-6,8-9,11-12,14,22H,7,10,13H2,1H3/p+1/t20-/m0/s1 |
| InChIKey | NMIRKZWCHKQRAV-FQEVSTJZSA-O |
| XLogP | 3.57 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|