C19H22O3 — CID 10637822
(5S,6S,12E)-12-benzylidene-4,7-dioxadispiro[4.0.46.45]tetradecan-11-one (PubChem CID 10637822) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (5S,6S,12E)-12-benzylidene-4,7-dioxadispiro[4.0.46.45]tetradecan-11-one.
| Compound Name | (5S,6S,12E)-12-benzylidene-4,7-dioxadispiro[4.0.46.45]tetradecan-11-one |
|---|---|
| PubChem CID | 10637822 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (5S,6S,12E)-12-benzylidene-4,7-dioxadispiro[4.0.46.45]tetradecan-11-one |
| SMILES | O=C1/C(=C/c2ccccc2)CC[C@]2(CCCO2)[C@@]12CCCO2 |
| InChI | InChI=1S/C19H22O3/c20-17-16(14-15-6-2-1-3-7-15)8-11-18(9-4-12-21-18)19(17)10-5-13-22-19/h1-3,6-7,14H,4-5,8-13H2/b16-14+/t18-,19-/m1/s1 |
| InChIKey | RUANXNKNYYZHHD-VVTZJZJLSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|