About (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane
(3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane (PubChem CID 134982477) has the molecular formula C23H24O
and a molecular weight of 316.44 g/mol. Its IUPAC name is (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane.
Molecular Properties
| Compound Name | (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane |
| PubChem CID | 134982477 |
| Molecular Formula | C23H24O |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane |
| SMILES | C(=C1\COC2(CCCCC2)\C1=C\c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C23H24O/c1-4-10-19(11-5-1)16-21-18-24-23(14-8-3-9-15-23)22(21)17-20-12-6-2-7-13-20/h1-2,4-7,10-13,16-17H,3,8-9,14-15,18H2/b21-16+,22-17+ |
| InChIKey | VPAWFPCOHHGAPQ-LPFJTETCSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane?
The IUPAC name of (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane (CID 134982477) is (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane.
What is the SMILES notation for (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane?
The canonical SMILES for (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane is C(=C1\COC2(CCCCC2)\C1=C\c1ccccc1)\c1ccccc1.
What is the InChIKey of (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane?
The InChIKey is VPAWFPCOHHGAPQ-LPFJTETCSA-N. The full InChI is InChI=1S/C23H24O/c1-4-10-19(11-5-1)16-21-18-24-23(14-8-3-9-15-23)22(21)17-20-12-6-2-7-13-20/h1-2,4-7,10-13,16-17H,3,8-9,14-15,18H2/b21-16+,22-17+.
What are the key properties of (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane?
(3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane has a molecular weight of 316.44 g/mol, XLogP of 5.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,4E)-3,4-dibenzylidene-1-oxaspiro[4.5]decane is sourced from PubChem (CID 134982477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).