C25H26O2 — CID 6385330
(6Z)-6-benzylidene-2-methyl-2-[(E)-3-oxo-5-phenylpent-4-enyl]cyclohexan-1-one (PubChem CID 6385330) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is (6Z)-6-benzylidene-2-methyl-2-[(E)-3-oxo-5-phenylpent-4-enyl]cyclohexan-1-one.
| Compound Name | (6Z)-6-benzylidene-2-methyl-2-[(E)-3-oxo-5-phenylpent-4-enyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 6385330 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (6Z)-6-benzylidene-2-methyl-2-[(E)-3-oxo-5-phenylpent-4-enyl]cyclohexan-1-one |
| SMILES | CC1(CCC(=O)/C=C/c2ccccc2)CCC/C(=C/c2ccccc2)C1=O |
| InChI | InChI=1S/C25H26O2/c1-25(18-16-23(26)15-14-20-9-4-2-5-10-20)17-8-13-22(24(25)27)19-21-11-6-3-7-12-21/h2-7,9-12,14-15,19H,8,13,16-18H2,1H3/b15-14+,22-19- |
| InChIKey | UNZSYZJRBRTXKI-PSRUBWQCSA-N |
| XLogP | 5.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|