C38H42N2O4P2 — CID 102253993
(3aS)-1-[4-[[(3aS)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]butoxy]-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphole (PubChem CID 102253993) has the molecular formula C38H42N2O4P2 and a molecular weight of 652.71 g/mol. Its IUPAC name is (3aS)-1-[4-[[(3aS)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]butoxy]-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphole.
| Compound Name | (3aS)-1-[4-[[(3aS)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]butoxy]-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphole |
|---|---|
| PubChem CID | 102253993 |
| Molecular Formula | C38H42N2O4P2 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | (3aS)-1-[4-[[(3aS)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]oxy]butoxy]-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphole |
| SMILES | c1ccc(C2(c3ccccc3)OP(OCCCCOP3OC(c4ccccc4)(c4ccccc4)[C@@H]4CCCN43)N3CCC[C@H]32)cc1 |
| InChI | InChI=1S/C38H42N2O4P2/c1-5-17-31(18-6-1)37(32-19-7-2-8-20-32)35-25-15-27-39(35)45(43-37)41-29-13-14-30-42-46-40-28-16-26-36(40)38(44-46,33-21-9-3-10-22-33)34-23-11-4-12-24-34/h1-12,17-24,35-36H,13-16,25-30H2/t35-,36-,45?,46?/m0/s1 |
| InChIKey | RQDXCWMQQAQUME-AVJWCBOLSA-N |
| XLogP | 9.13 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|