C12H15BNO — CID 174164192
CID 174164192 (PubChem CID 174164192) has the molecular formula C12H15BNO and a molecular weight of 200.07 g/mol.
| Compound Name | CID 174164192 |
|---|---|
| PubChem CID | 174164192 |
| Molecular Formula | C12H15BNO |
| Molecular Weight | 200.07 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | — |
| SMILES | C[C@]1(c2ccccc2)O[B]N2CCCC21 |
| InChI | InChI=1S/C12H15BNO/c1-12(10-6-3-2-4-7-10)11-8-5-9-14(11)13-15-12/h2-4,6-7,11H,5,8-9H2,1H3/t11?,12-/m1/s1 |
| InChIKey | JCQQSPOSOWFKFI-PIJUOVFKSA-N |
| XLogP | 1.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.07 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|