C25H26BNO — CID 101174986
(3aS)-1-(2,6-dimethylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 101174986) has the molecular formula C25H26BNO and a molecular weight of 367.30 g/mol. Its IUPAC name is (3aS)-1-(2,6-dimethylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | (3aS)-1-(2,6-dimethylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 101174986 |
| Molecular Formula | C25H26BNO |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (3aS)-1-(2,6-dimethylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | Cc1cccc(C)c1B1OC(c2ccccc2)(c2ccccc2)[C@@H]2CCCN12 |
| InChI | InChI=1S/C25H26BNO/c1-19-11-9-12-20(2)24(19)26-27-18-10-17-23(27)25(28-26,21-13-5-3-6-14-21)22-15-7-4-8-16-22/h3-9,11-16,23H,10,17-18H2,1-2H3/t23-/m0/s1 |
| InChIKey | QUGMATQKSMCMHG-QHCPKHFHSA-N |
| XLogP | 4.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|