C25H27BNO+ — CID 134941356
(3aR,7S)-7-methyl-1-(2-methylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium (PubChem CID 134941356) has the molecular formula C25H27BNO+ and a molecular weight of 368.31 g/mol. Its IUPAC name is (3aR,7S)-7-methyl-1-(2-methylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium.
| Compound Name | (3aR,7S)-7-methyl-1-(2-methylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium |
|---|---|
| PubChem CID | 134941356 |
| Molecular Formula | C25H27BNO+ |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (3aR,7S)-7-methyl-1-(2-methylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium |
| SMILES | Cc1ccccc1B1OC(c2ccccc2)(c2ccccc2)[C@H]2CCC[N@@+]12C |
| InChI | InChI=1S/C25H27BNO/c1-20-12-9-10-17-23(20)26-27(2)19-11-18-24(27)25(28-26,21-13-5-3-6-14-21)22-15-7-4-8-16-22/h3-10,12-17,24H,11,18-19H2,1-2H3/q+1/t24-,27-/m1/s1 |
| InChIKey | BFFNFHUGEFWDNN-SHQCIBLASA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|