C22H28BNO2 — CID 140830297
N-(2-methylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 140830297) has the molecular formula C22H28BNO2 and a molecular weight of 349.28 g/mol. Its IUPAC name is N-(2-methylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(2-methylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 140830297 |
| Molecular Formula | C22H28BNO2 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-(2-methylphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | Cc1ccccc1NC1CCc2cccc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C22H28BNO2/c1-15-9-6-7-12-18(15)24-19-14-13-16-10-8-11-17(20(16)19)23-25-21(2,3)22(4,5)26-23/h6-12,19,24H,13-14H2,1-5H3 |
| InChIKey | XGSKLESSFXPOCQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|